C10H14IN3O — CID 136993934
5-iodo-4-(4-methylpiperidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 136993934) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 5-iodo-4-(4-methylpiperidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(4-methylpiperidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136993934 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-iodo-4-(4-methylpiperidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | CC1CCN(c2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C10H14IN3O/c1-7-2-4-14(5-3-7)9-8(11)10(15)13-6-12-9/h6-7H,2-5H2,1H3,(H,12,13,15) |
| InChIKey | YMBMAEXBZXRSRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|