C10H11F3IN3O — CID 137015676
5-iodo-4-[3-(trifluoromethyl)piperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 137015676) has the molecular formula C10H11F3IN3O and a molecular weight of 373.12 g/mol. Its IUPAC name is 5-iodo-4-[3-(trifluoromethyl)piperidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[3-(trifluoromethyl)piperidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137015676 |
| Molecular Formula | C10H11F3IN3O |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 5-iodo-4-[3-(trifluoromethyl)piperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCCC(C(F)(F)F)C2)c1I |
| InChI | InChI=1S/C10H11F3IN3O/c11-10(12,13)6-2-1-3-17(4-6)8-7(14)9(18)16-5-15-8/h5-6H,1-4H2,(H,15,16,18) |
| InChIKey | NVPFBASWOBUSFB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|