C10H4BrF2NO4 — CID 136995105
3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 136995105) has the molecular formula C10H4BrF2NO4 and a molecular weight of 320.05 g/mol. Its IUPAC name is 3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136995105 |
| Molecular Formula | C10H4BrF2NO4 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(O)c(Br)cc(F)c2F)no1 |
| InChI | InChI=1S/C10H4BrF2NO4/c11-3-1-4(12)8(13)7(9(3)15)5-2-6(10(16)17)18-14-5/h1-2,15H,(H,16,17) |
| InChIKey | OUGMLZSWXULXSH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|