C15H9Cl2FN2O — CID 136996138
3-[(2,3-dichlorophenyl)iminomethyl]-5-fluoro-1H-indol-2-ol (PubChem CID 136996138) has the molecular formula C15H9Cl2FN2O and a molecular weight of 323.15 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)iminomethyl]-5-fluoro-1H-indol-2-ol.
| Compound Name | 3-[(2,3-dichlorophenyl)iminomethyl]-5-fluoro-1H-indol-2-ol |
|---|---|
| PubChem CID | 136996138 |
| Molecular Formula | C15H9Cl2FN2O |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)iminomethyl]-5-fluoro-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(F)cc2c1/C=N/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H9Cl2FN2O/c16-11-2-1-3-13(14(11)17)19-7-10-9-6-8(18)4-5-12(9)20-15(10)21/h1-7,20-21H/b19-7+ |
| InChIKey | NIUVQYSGPDJFKY-FBCYGCLPSA-N |
| XLogP | 5.07 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|