C15H9ClF2N2O — CID 137006510
6-chloro-3-[(2,6-difluorophenyl)iminomethyl]-1H-indol-2-ol (PubChem CID 137006510) has the molecular formula C15H9ClF2N2O and a molecular weight of 306.70 g/mol. Its IUPAC name is 6-chloro-3-[(2,6-difluorophenyl)iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-chloro-3-[(2,6-difluorophenyl)iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137006510 |
| Molecular Formula | C15H9ClF2N2O |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-chloro-3-[(2,6-difluorophenyl)iminomethyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2cc(Cl)ccc2c1/C=N/c1c(F)cccc1F |
| InChI | InChI=1S/C15H9ClF2N2O/c16-8-4-5-9-10(15(21)20-13(9)6-8)7-19-14-11(17)2-1-3-12(14)18/h1-7,20-21H/b19-7+ |
| InChIKey | NBLPJRZCCGDUBB-FBCYGCLPSA-N |
| XLogP | 4.56 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|