C17H15ClN2O — CID 137006420
6-chloro-3-[(2,5-dimethylphenyl)iminomethyl]-1H-indol-2-ol (PubChem CID 137006420) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 6-chloro-3-[(2,5-dimethylphenyl)iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-chloro-3-[(2,5-dimethylphenyl)iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137006420 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 6-chloro-3-[(2,5-dimethylphenyl)iminomethyl]-1H-indol-2-ol |
| SMILES | Cc1ccc(C)c(/N=C/c2c(O)[nH]c3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C17H15ClN2O/c1-10-3-4-11(2)15(7-10)19-9-14-13-6-5-12(18)8-16(13)20-17(14)21/h3-9,20-21H,1-2H3/b19-9+ |
| InChIKey | HFSVMCBUZPTNRO-DJKKODMXSA-N |
| XLogP | 4.89 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|