C17H15ClN2O3 — CID 137006458
6-chloro-3-[(2,4-dimethoxyphenyl)iminomethyl]-1H-indol-2-ol (PubChem CID 137006458) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 6-chloro-3-[(2,4-dimethoxyphenyl)iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-chloro-3-[(2,4-dimethoxyphenyl)iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137006458 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-chloro-3-[(2,4-dimethoxyphenyl)iminomethyl]-1H-indol-2-ol |
| SMILES | COc1ccc(/N=C/c2c(O)[nH]c3cc(Cl)ccc23)c(OC)c1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-11-4-6-14(16(8-11)23-2)19-9-13-12-5-3-10(18)7-15(12)20-17(13)21/h3-9,20-21H,1-2H3/b19-9+ |
| InChIKey | VMTWTBBZVQTDGS-DJKKODMXSA-N |
| XLogP | 4.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|