C15H14ClNO2 — CID 91664646
1-(4-chlorophenyl)-N-(2,4-dimethoxyphenyl)methanimine (PubChem CID 91664646) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2,4-dimethoxyphenyl)methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-(2,4-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 91664646 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2,4-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(/N=C/c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H14ClNO2/c1-18-13-7-8-14(15(9-13)19-2)17-10-11-3-5-12(16)6-4-11/h3-10H,1-2H3/b17-10+ |
| InChIKey | OFBTVRGOWNZEBP-LICLKQGHSA-N |
| XLogP | 4.11 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|