C14H19NO2Si — CID 54067366
N-(2,4-dimethoxyphenyl)-3-trimethylsilylprop-2-yn-1-imine (PubChem CID 54067366) has the molecular formula C14H19NO2Si and a molecular weight of 261.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-trimethylsilylprop-2-yn-1-imine.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-trimethylsilylprop-2-yn-1-imine |
|---|---|
| PubChem CID | 54067366 |
| Molecular Formula | C14H19NO2Si |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-trimethylsilylprop-2-yn-1-imine |
| SMILES | COc1ccc(/N=C/C#C[Si](C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H19NO2Si/c1-16-12-7-8-13(14(11-12)17-2)15-9-6-10-18(3,4)5/h7-9,11H,1-5H3/b15-9+ |
| InChIKey | MDYMRTBWASEVMT-OQLLNIDSSA-N |
| XLogP | 3.29 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|