C14H16ClNO — CID 90846710
6-chloro-3-(3,3-dimethylbut-1-enyl)-1H-indol-2-ol (PubChem CID 90846710) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 6-chloro-3-(3,3-dimethylbut-1-enyl)-1H-indol-2-ol.
| Compound Name | 6-chloro-3-(3,3-dimethylbut-1-enyl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 90846710 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 6-chloro-3-(3,3-dimethylbut-1-enyl)-1H-indol-2-ol |
| SMILES | CC(C)(C)C=Cc1c(O)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H16ClNO/c1-14(2,3)7-6-11-10-5-4-9(15)8-12(10)16-13(11)17/h4-8,16-17H,1-3H3 |
| InChIKey | AGMNUUOXOLCBNG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |