C12H15Cl — CID 59987342
1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene (PubChem CID 59987342) has the molecular formula C12H15Cl and a molecular weight of 194.70 g/mol. Its IUPAC name is 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene.
| Compound Name | 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 59987342 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-chloro-3-[(E)-3,3-dimethylbut-1-enyl]benzene |
| SMILES | CC(C)(C)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl/c1-12(2,3)8-7-10-5-4-6-11(13)9-10/h4-9H,1-3H3/b8-7+ |
| InChIKey | NXDPLPJFCQQUEQ-BQYQJAHWSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |