C46H36N4 — CID 136999350
6-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(6-methyl-3-pyridinyl)phenyl]-2,4-diphenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 136999350) has the molecular formula C46H36N4 and a molecular weight of 644.82 g/mol. Its IUPAC name is 6-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(6-methyl-3-pyridinyl)phenyl]-2,4-diphenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | 6-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(6-methyl-3-pyridinyl)phenyl]-2,4-diphenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 136999350 |
| Molecular Formula | C46H36N4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | 6-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(6-methyl-3-pyridinyl)phenyl]-2,4-diphenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cc(C3=NC(c4ccccc4)=NC(c4ccccc4)N3)cc(-c3cc4c(c5ccccc35)-c3ccccc3C4(C)C)c2)cn1 |
| InChI | InChI=1S/C46H36N4/c1-29-22-23-32(28-47-29)33-24-34(39-27-41-42(37-19-11-10-18-36(37)39)38-20-12-13-21-40(38)46(41,2)3)26-35(25-33)45-49-43(30-14-6-4-7-15-30)48-44(50-45)31-16-8-5-9-17-31/h4-28,43H,1-3H3,(H,48,49,50) |
| InChIKey | KQFOYVWCJLSNKH-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |