C13H25N3OS — CID 137000888
N-[(4-ethylmorpholin-2-yl)methyl]-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 137000888) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 137000888 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CCN1CCOC(C/N=C2/NC(C)(C)CCS2)C1 |
| InChI | InChI=1S/C13H25N3OS/c1-4-16-6-7-17-11(10-16)9-14-12-15-13(2,3)5-8-18-12/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | QCFCBDALUNEPDK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|