C17H16ClN5O2 — CID 137002431
(5S)-5-(4-chlorophenyl)-12-[(3R)-oxolan-3-yl]-1,2,4,7,11-pentazatricyclo[7.3.0.03,7]dodeca-2,9,11-trien-8-one (PubChem CID 137002431) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is (5S)-5-(4-chlorophenyl)-12-[(3R)-oxolan-3-yl]-1,2,4,7,11-pentazatricyclo[7.3.0.03,7]dodeca-2,9,11-trien-8-one.
| Compound Name | (5S)-5-(4-chlorophenyl)-12-[(3R)-oxolan-3-yl]-1,2,4,7,11-pentazatricyclo[7.3.0.03,7]dodeca-2,9,11-trien-8-one |
|---|---|
| PubChem CID | 137002431 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5S)-5-(4-chlorophenyl)-12-[(3R)-oxolan-3-yl]-1,2,4,7,11-pentazatricyclo[7.3.0.03,7]dodeca-2,9,11-trien-8-one |
| SMILES | O=c1c2cnc([C@H]3CCOC3)n2nc2n1C[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C17H16ClN5O2/c18-12-3-1-10(2-4-12)13-8-22-16(24)14-7-19-15(11-5-6-25-9-11)23(14)21-17(22)20-13/h1-4,7,11,13H,5-6,8-9H2,(H,20,21)/t11-,13+/m0/s1 |
| InChIKey | OXFWPVSLAAOWKW-WCQYABFASA-N |
| XLogP | 2.22 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |