C19H19ClN4O2 — CID 70778944
6-(2-chlorophenyl)-N-methyl-7-(3-methylbut-2-enyl)-8-oxoimidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 70778944) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-N-methyl-7-(3-methylbut-2-enyl)-8-oxoimidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 6-(2-chlorophenyl)-N-methyl-7-(3-methylbut-2-enyl)-8-oxoimidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70778944 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 6-(2-chlorophenyl)-N-methyl-7-(3-methylbut-2-enyl)-8-oxoimidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CNC(=O)c1cn2cc(-c3ccccc3Cl)n(CC=C(C)C)c(=O)c2n1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12(2)8-9-24-16(13-6-4-5-7-14(13)20)11-23-10-15(18(25)21-3)22-17(23)19(24)26/h4-8,10-11H,9H2,1-3H3,(H,21,25) |
| InChIKey | FKRYKSUXGGZMSI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|