C12H12N2O5S — CID 137003457
5-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 137003457) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 137003457 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)cc1-c1cc(S(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C12H12N2O5S/c1-14-10(6-9(13-14)12(16)17)8-5-7(20(2,18)19)3-4-11(8)15/h3-6,15H,1-2H3,(H,16,17) |
| InChIKey | KJHZUMYLPZQZQX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |