C15H17N3O4 — CID 136966493
5-(2-hydroxy-5-morpholin-4-ylphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 136966493) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 5-(2-hydroxy-5-morpholin-4-ylphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(2-hydroxy-5-morpholin-4-ylphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136966493 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 5-(2-hydroxy-5-morpholin-4-ylphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)cc1-c1cc(N2CCOCC2)ccc1O |
| InChI | InChI=1S/C15H17N3O4/c1-17-13(9-12(16-17)15(20)21)11-8-10(2-3-14(11)19)18-4-6-22-7-5-18/h2-3,8-9,19H,4-7H2,1H3,(H,20,21) |
| InChIKey | GFNVXZPSRCUBSK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |