C14H13N3O — CID 137004995
3-methyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)phenol (PubChem CID 137004995) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-methyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)phenol.
| Compound Name | 3-methyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 137004995 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-methyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)phenol |
| SMILES | Cc1cc(O)ccc1-c1nc2ncccc2n1C |
| InChI | InChI=1S/C14H13N3O/c1-9-8-10(18)5-6-11(9)14-16-13-12(17(14)2)4-3-7-15-13/h3-8,18H,1-2H3 |
| InChIKey | XXESUAHPCJDDKI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |