C13H12N4 — CID 114113127
4-(1-methylimidazo[4,5-b]pyridin-2-yl)aniline (PubChem CID 114113127) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-(1-methylimidazo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 4-(1-methylimidazo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 114113127 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-(1-methylimidazo[4,5-b]pyridin-2-yl)aniline |
| SMILES | Cn1c(-c2ccc(N)cc2)nc2ncccc21 |
| InChI | InChI=1S/C13H12N4/c1-17-11-3-2-8-15-12(11)16-13(17)9-4-6-10(14)7-5-9/h2-8H,14H2,1H3 |
| InChIKey | AUZOBDVPQZFYHN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|