C14H13ClN2OS — CID 137005262
(E)-N-(4-chloro-3-methylphenyl)-2-cyano-3-cyclopropyl-3-hydroxyprop-2-enethioamide (PubChem CID 137005262) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is (E)-N-(4-chloro-3-methylphenyl)-2-cyano-3-cyclopropyl-3-hydroxyprop-2-enethioamide.
| Compound Name | (E)-N-(4-chloro-3-methylphenyl)-2-cyano-3-cyclopropyl-3-hydroxyprop-2-enethioamide |
|---|---|
| PubChem CID | 137005262 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (E)-N-(4-chloro-3-methylphenyl)-2-cyano-3-cyclopropyl-3-hydroxyprop-2-enethioamide |
| SMILES | Cc1cc(NC(=S)/C(C#N)=C(/O)C2CC2)ccc1Cl |
| InChI | InChI=1S/C14H13ClN2OS/c1-8-6-10(4-5-12(8)15)17-14(19)11(7-16)13(18)9-2-3-9/h4-6,9,18H,2-3H2,1H3,(H,17,19)/b13-11+ |
| InChIKey | PNLTYMQODLEQOQ-ACCUITESSA-N |
| XLogP | 4.13 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|