C25H26N4O3S — CID 137006691
N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-cyclohexyl-1H-pyrrol-2-yl]-2-methoxybenzamide (PubChem CID 137006691) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-cyclohexyl-1H-pyrrol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-cyclohexyl-1H-pyrrol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 137006691 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-cyclohexyl-1H-pyrrol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1[nH]c(ON)c(C2CCCCC2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H26N4O3S/c1-31-18-13-7-5-11-16(18)23(30)28-22-21(25-27-17-12-6-8-14-19(17)33-25)20(24(29-22)32-26)15-9-3-2-4-10-15/h5-8,11-15,29H,2-4,9-10,26H2,1H3,(H,28,30) |
| InChIKey | MHTFHIOLSYJLRP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|