C29H22N4O2S — CID 137006711
N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-naphthalen-1-yl-1H-pyrrol-2-yl]-2-methylbenzamide (PubChem CID 137006711) has the molecular formula C29H22N4O2S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-naphthalen-1-yl-1H-pyrrol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-naphthalen-1-yl-1H-pyrrol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 137006711 |
| Molecular Formula | C29H22N4O2S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[5-aminooxy-3-(1,3-benzothiazol-2-yl)-4-naphthalen-1-yl-1H-pyrrol-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1[nH]c(ON)c(-c2cccc3ccccc23)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H22N4O2S/c1-17-9-2-4-12-19(17)27(34)32-26-25(29-31-22-15-6-7-16-23(22)36-29)24(28(33-26)35-30)21-14-8-11-18-10-3-5-13-20(18)21/h2-16,33H,30H2,1H3,(H,32,34) |
| InChIKey | XHFAKNGROHIYCH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|