3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

C12H12N2O3 — CID 137007277

IUPAC3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCc1cc(C)c(-c2cc(C(=O)O)[nH]n2)c(O)c1
InChIInChI=1S/C12H12N2O3/c1-6-3-7(2)11(10(15)4-6)8-5-9(12(16)17)14-13-8/h3-5,15H,1-2H3,(H,13,14)(H,16,17)
InChIKeyLSTYBFWGKYDHCW-UHFFFAOYSA-N
MW232.24 g/mol
LogP2.10
Rot. Bonds2

About 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 137007277) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
PubChem CID137007277
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCc1cc(C)c(-c2cc(C(=O)O)[nH]n2)c(O)c1
InChIInChI=1S/C12H12N2O3/c1-6-3-7(2)11(10(15)4-6)8-5-9(12(16)17)14-13-8/h3-5,15H,1-2H3,(H,13,14)(H,16,17)
InChIKeyLSTYBFWGKYDHCW-UHFFFAOYSA-N
XLogP2.10
TPSA86.21 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 52.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (CID 137007277) is 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is Cc1cc(C)c(-c2cc(C(=O)O)[nH]n2)c(O)c1.
What is the InChIKey of 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is LSTYBFWGKYDHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-6-3-7(2)11(10(15)4-6)8-5-9(12(16)17)14-13-8/h3-5,15H,1-2H3,(H,13,14)(H,16,17).
What are the key properties of 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 2.10, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 137007277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).