C11H15F2N3O — CID 137010975
4-amino-2-(3,3-difluorocyclohexyl)-5-methyl-1H-pyrimidin-6-one (PubChem CID 137010975) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-amino-2-(3,3-difluorocyclohexyl)-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(3,3-difluorocyclohexyl)-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137010975 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-amino-2-(3,3-difluorocyclohexyl)-5-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(N)nc(C2CCCC(F)(F)C2)[nH]c1=O |
| InChI | InChI=1S/C11H15F2N3O/c1-6-8(14)15-9(16-10(6)17)7-3-2-4-11(12,13)5-7/h7H,2-5H2,1H3,(H3,14,15,16,17) |
| InChIKey | XNPLQCCWBUDVDD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |