C10H7FN4O — CID 137013108
5-(3-amino-1H-pyrazol-5-yl)-3-fluoro-2-hydroxybenzonitrile (PubChem CID 137013108) has the molecular formula C10H7FN4O and a molecular weight of 218.19 g/mol. Its IUPAC name is 5-(3-amino-1H-pyrazol-5-yl)-3-fluoro-2-hydroxybenzonitrile.
| Compound Name | 5-(3-amino-1H-pyrazol-5-yl)-3-fluoro-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 137013108 |
| Molecular Formula | C10H7FN4O |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-(3-amino-1H-pyrazol-5-yl)-3-fluoro-2-hydroxybenzonitrile |
| SMILES | N#Cc1cc(-c2cc(N)n[nH]2)cc(F)c1O |
| InChI | InChI=1S/C10H7FN4O/c11-7-2-5(1-6(4-12)10(7)16)8-3-9(13)15-14-8/h1-3,16H,(H3,13,14,15) |
| InChIKey | ZIWOIBQVMFUSST-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |