C14H14N4OS — CID 137013863
2-methyl-6-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carbonitrile (PubChem CID 137013863) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-methyl-6-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 137013863 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-methyl-6-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carbonitrile |
| SMILES | CCCc1cc(=O)[nH]c(Sc2cc(C#N)cc(C)n2)n1 |
| InChI | InChI=1S/C14H14N4OS/c1-3-4-11-7-12(19)18-14(17-11)20-13-6-10(8-15)5-9(2)16-13/h5-7H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | ZWICEJRNKVPNSP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |