C15H17N3OS — CID 137013924
N'-hydroxy-2-methyl-6-[(2-methylphenyl)methylsulfanyl]pyridine-4-carboximidamide (PubChem CID 137013924) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-6-[(2-methylphenyl)methylsulfanyl]pyridine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-methyl-6-[(2-methylphenyl)methylsulfanyl]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 137013924 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N'-hydroxy-2-methyl-6-[(2-methylphenyl)methylsulfanyl]pyridine-4-carboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)cc(SCc2ccccc2C)n1 |
| InChI | InChI=1S/C15H17N3OS/c1-10-5-3-4-6-12(10)9-20-14-8-13(15(16)18-19)7-11(2)17-14/h3-8,19H,9H2,1-2H3,(H2,16,18) |
| InChIKey | ATLVNQLCSSMMQQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|