C13H15N5OS — CID 137013920
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N'-hydroxy-6-methylpyridine-4-carboximidamide (PubChem CID 137013920) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N'-hydroxy-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N'-hydroxy-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 137013920 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N'-hydroxy-6-methylpyridine-4-carboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)cc(Sc2nc(C)cc(C)n2)n1 |
| InChI | InChI=1S/C13H15N5OS/c1-7-4-8(2)17-13(16-7)20-11-6-10(12(14)18-19)5-9(3)15-11/h4-6,19H,1-3H3,(H2,14,18) |
| InChIKey | OSKXXZKAXWFSML-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|