C9H10N6OS — CID 136925035
N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboximidamide (PubChem CID 136925035) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136925035 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboximidamide |
| SMILES | Cc1nc(Sc2cc(/C(N)=N/O)ccn2)n[nH]1 |
| InChI | InChI=1S/C9H10N6OS/c1-5-12-9(14-13-5)17-7-4-6(2-3-11-7)8(10)15-16/h2-4,16H,1H3,(H2,10,15)(H,12,13,14) |
| InChIKey | GVNLUUMOESQFRN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|