About 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine
4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine (PubChem CID 80891874) has the molecular formula C7H8N6S
and a molecular weight of 208.25 g/mol. Its IUPAC name is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine |
| PubChem CID | 80891874 |
| Molecular Formula | C7H8N6S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine |
| SMILES | Cc1nc(Sc2ccnc(N)n2)n[nH]1 |
| InChI | InChI=1S/C7H8N6S/c1-4-10-7(13-12-4)14-5-2-3-9-6(8)11-5/h2-3H,1H3,(H2,8,9,11)(H,10,12,13) |
| InChIKey | PFICLQWWPZXETI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine?
The IUPAC name of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine (CID 80891874) is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine.
What is the SMILES notation for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine?
The canonical SMILES for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine is Cc1nc(Sc2ccnc(N)n2)n[nH]1.
What is the InChIKey of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine?
The InChIKey is PFICLQWWPZXETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6S/c1-4-10-7(13-12-4)14-5-2-3-9-6(8)11-5/h2-3H,1H3,(H2,8,9,11)(H,10,12,13).
What are the key properties of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine?
4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine has a molecular weight of 208.25 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-amine is sourced from PubChem (CID 80891874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).