C20H22FN5O — CID 137013977
(15R)-4-fluoro-7-oxa-11,17,21,22,25-pentazapentacyclo[16.5.2.12,6.011,15.021,24]hexacosa-1(24),2(26),3,5,18(25),19,22-heptaene (PubChem CID 137013977) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is (15R)-4-fluoro-7-oxa-11,17,21,22,25-pentazapentacyclo[16.5.2.12,6.011,15.021,24]hexacosa-1(24),2(26),3,5,18(25),19,22-heptaene.
| Compound Name | (15R)-4-fluoro-7-oxa-11,17,21,22,25-pentazapentacyclo[16.5.2.12,6.011,15.021,24]hexacosa-1(24),2(26),3,5,18(25),19,22-heptaene |
|---|---|
| PubChem CID | 137013977 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (15R)-4-fluoro-7-oxa-11,17,21,22,25-pentazapentacyclo[16.5.2.12,6.011,15.021,24]hexacosa-1(24),2(26),3,5,18(25),19,22-heptaene |
| SMILES | Fc1cc2cc(c1)-c1cnn3ccc(nc13)NC[C@H]1CCCN1CCCO2 |
| InChI | InChI=1S/C20H22FN5O/c21-15-9-14-10-17(11-15)27-8-2-6-25-5-1-3-16(25)12-22-19-4-7-26-20(24-19)18(14)13-23-26/h4,7,9-11,13,16H,1-3,5-6,8,12H2,(H,22,24)/t16-/m1/s1 |
| InChIKey | KLHLBYYXDWZTGO-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |