C19H21BN6O2 — CID 144702348
4-formyl-7-oxa-13,17,18,21-tetraza-10-boratetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-10-carbonitrile;methanamine (PubChem CID 144702348) has the molecular formula C19H21BN6O2 and a molecular weight of 376.23 g/mol. Its IUPAC name is 4-formyl-7-oxa-13,17,18,21-tetraza-10-boratetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-10-carbonitrile;methanamine.
| Compound Name | 4-formyl-7-oxa-13,17,18,21-tetraza-10-boratetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-10-carbonitrile;methanamine |
|---|---|
| PubChem CID | 144702348 |
| Molecular Formula | C19H21BN6O2 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-formyl-7-oxa-13,17,18,21-tetraza-10-boratetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-10-carbonitrile;methanamine |
| SMILES | CN.N#CB1CCNc2ccn3ncc(c3n2)-c2cc(C=O)cc(c2)OCC1 |
| InChI | InChI=1S/C18H16BN5O2.CH5N/c20-12-19-2-4-21-17-1-5-24-18(23-17)16(10-22-24)14-7-13(11-25)8-15(9-14)26-6-3-19;1-2/h1,5,7-11H,2-4,6H2,(H,21,23);2H2,1H3 |
| InChIKey | BEPYNVXMMJMXQO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|