C17H19FN6O — CID 137210892
3-fluoro-7-oxa-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene (PubChem CID 137210892) has the molecular formula C17H19FN6O and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-fluoro-7-oxa-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene.
| Compound Name | 3-fluoro-7-oxa-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene |
|---|---|
| PubChem CID | 137210892 |
| Molecular Formula | C17H19FN6O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-fluoro-7-oxa-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene |
| SMILES | Fc1ccc2cc1-c1cnn3ccc(nc13)NCCNCCNCO2 |
| InChI | InChI=1S/C17H19FN6O/c18-15-2-1-12-9-13(15)14-10-22-24-8-3-16(23-17(14)24)21-7-6-19-4-5-20-11-25-12/h1-3,8-10,19-20H,4-7,11H2,(H,21,23) |
| InChIKey | AMYPXINGQPLFGC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |