C19H20FN7 — CID 136644755
2-(3-fluoro-7,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2,4,6(23),15(22),16,19-heptaen-11-yl)acetonitrile (PubChem CID 136644755) has the molecular formula C19H20FN7 and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-(3-fluoro-7,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2,4,6(23),15(22),16,19-heptaen-11-yl)acetonitrile.
| Compound Name | 2-(3-fluoro-7,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2,4,6(23),15(22),16,19-heptaen-11-yl)acetonitrile |
|---|---|
| PubChem CID | 136644755 |
| Molecular Formula | C19H20FN7 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-(3-fluoro-7,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2,4,6(23),15(22),16,19-heptaen-11-yl)acetonitrile |
| SMILES | N#CCN1CCCNc2ccc(F)c(c2)-c2cnn3ccc(nc23)NCC1 |
| InChI | InChI=1S/C19H20FN7/c20-17-3-2-14-12-15(17)16-13-24-27-9-4-18(25-19(16)27)23-7-11-26(10-5-21)8-1-6-22-14/h2-4,9,12-13,22H,1,6-8,10-11H2,(H,23,25) |
| InChIKey | LSSDRSQZVXLZEQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|