3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid

C11H17N3O3 — CID 137015126

IUPAC3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid
SMILESO=C(O)CCc1nn(C2CCCCC2)c(=O)[nH]1
InChIInChI=1S/C11H17N3O3/c15-10(16)7-6-9-12-11(17)14(13-9)8-4-2-1-3-5-8/h8H,1-7H2,(H,15,16)(H,12,13,17)
InChIKeyWWQNUOBWZYVIJK-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.09
Rot. Bonds4

About 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid

3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 137015126) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid
PubChem CID137015126
Molecular FormulaC11H17N3O3
Molecular Weight239.27 g/mol
Exact Mass239.13
IUPAC Name3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid
SMILESO=C(O)CCc1nn(C2CCCCC2)c(=O)[nH]1
InChIInChI=1S/C11H17N3O3/c15-10(16)7-6-9-12-11(17)14(13-9)8-4-2-1-3-5-8/h8H,1-7H2,(H,15,16)(H,12,13,17)
InChIKeyWWQNUOBWZYVIJK-UHFFFAOYSA-N
XLogP1.09
TPSA87.98 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid?
The IUPAC name of 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid (CID 137015126) is 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid.
What is the SMILES notation for 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid?
The canonical SMILES for 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid is O=C(O)CCc1nn(C2CCCCC2)c(=O)[nH]1.
What is the InChIKey of 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid?
The InChIKey is WWQNUOBWZYVIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c15-10(16)7-6-9-12-11(17)14(13-9)8-4-2-1-3-5-8/h8H,1-7H2,(H,15,16)(H,12,13,17).
What are the key properties of 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid?
3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid has a molecular weight of 239.27 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid is sourced from PubChem (CID 137015126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).