C11H17N3O3 — CID 137015126
3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 137015126) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid.
| Compound Name | 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 137015126 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-(1-cyclohexyl-5-oxo-4H-1,2,4-triazol-3-yl)propanoic acid |
| SMILES | O=C(O)CCc1nn(C2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N3O3/c15-10(16)7-6-9-12-11(17)14(13-9)8-4-2-1-3-5-8/h8H,1-7H2,(H,15,16)(H,12,13,17) |
| InChIKey | WWQNUOBWZYVIJK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |