C22H24N4O3 — CID 136814405
benzyl 4-(3-benzyl-5-oxo-4H-1,2,4-triazol-1-yl)piperidine-1-carboxylate (PubChem CID 136814405) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is benzyl 4-(3-benzyl-5-oxo-4H-1,2,4-triazol-1-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(3-benzyl-5-oxo-4H-1,2,4-triazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136814405 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | benzyl 4-(3-benzyl-5-oxo-4H-1,2,4-triazol-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(n2nc(Cc3ccccc3)[nH]c2=O)CC1 |
| InChI | InChI=1S/C22H24N4O3/c27-21-23-20(15-17-7-3-1-4-8-17)24-26(21)19-11-13-25(14-12-19)22(28)29-16-18-9-5-2-6-10-18/h1-10,19H,11-16H2,(H,23,24,27) |
| InChIKey | KILUTXZLYTXIFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |