C20H20ClN5O3 — CID 136814412
benzyl 4-[3-(2-chloro-4-pyridinyl)-5-oxo-4H-1,2,4-triazol-1-yl]piperidine-1-carboxylate (PubChem CID 136814412) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is benzyl 4-[3-(2-chloro-4-pyridinyl)-5-oxo-4H-1,2,4-triazol-1-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-(2-chloro-4-pyridinyl)-5-oxo-4H-1,2,4-triazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136814412 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | benzyl 4-[3-(2-chloro-4-pyridinyl)-5-oxo-4H-1,2,4-triazol-1-yl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(n2nc(-c3ccnc(Cl)c3)[nH]c2=O)CC1 |
| InChI | InChI=1S/C20H20ClN5O3/c21-17-12-15(6-9-22-17)18-23-19(27)26(24-18)16-7-10-25(11-8-16)20(28)29-13-14-4-2-1-3-5-14/h1-6,9,12,16H,7-8,10-11,13H2,(H,23,24,27) |
| InChIKey | ZIYMRBGSXXJKBX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|