C23H23N3O3 — CID 67438660
benzyl 4-(6-oxo-3-phenyl-1H-pyridazin-5-yl)piperidine-1-carboxylate (PubChem CID 67438660) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is benzyl 4-(6-oxo-3-phenyl-1H-pyridazin-5-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(6-oxo-3-phenyl-1H-pyridazin-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67438660 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | benzyl 4-(6-oxo-3-phenyl-1H-pyridazin-5-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(c2cc(-c3ccccc3)n[nH]c2=O)CC1 |
| InChI | InChI=1S/C23H23N3O3/c27-22-20(15-21(24-25-22)19-9-5-2-6-10-19)18-11-13-26(14-12-18)23(28)29-16-17-7-3-1-4-8-17/h1-10,15,18H,11-14,16H2,(H,25,27) |
| InChIKey | SQNZETCODIZWRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |