C29H29N3O2 — CID 164979886
benzyl 4-[5-(4-methylphenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidine-1-carboxylate (PubChem CID 164979886) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is benzyl 4-[5-(4-methylphenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[5-(4-methylphenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164979886 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | benzyl 4-[5-(4-methylphenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(-c2[nH]c(C3CCN(C(=O)OCc4ccccc4)CC3)cc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-21-7-9-25(10-8-21)28-26(23-11-15-30-16-12-23)19-27(31-28)24-13-17-32(18-14-24)29(33)34-20-22-5-3-2-4-6-22/h2-12,15-16,19,24,31H,13-14,17-18,20H2,1H3 |
| InChIKey | IJPCAGUJBQYZDR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |