C10H14ClN3O3 — CID 137016577
5-chloro-4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 137016577) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 5-chloro-4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016577 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 5-chloro-4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC2(O)CCOCC2)c1Cl |
| InChI | InChI=1S/C10H14ClN3O3/c11-7-8(13-6-14-9(7)15)12-5-10(16)1-3-17-4-2-10/h6,16H,1-5H2,(H2,12,13,14,15) |
| InChIKey | MSISMSNTNGLOSA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |