C10H16N4O3 — CID 137016650
5-amino-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 137016650) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-amino-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016650 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 5-amino-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | COC1(CNc2nc[nH]c(=O)c2N)CCOC1 |
| InChI | InChI=1S/C10H16N4O3/c1-16-10(2-3-17-5-10)4-12-8-7(11)9(15)14-6-13-8/h6H,2-5,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | REYLGPYTADOOIF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |