C10H14IN3O3 — CID 136957246
5-iodo-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136957246) has the molecular formula C10H14IN3O3 and a molecular weight of 351.14 g/mol. Its IUPAC name is 5-iodo-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957246 |
| Molecular Formula | C10H14IN3O3 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 5-iodo-4-[(3-methoxyoxolan-3-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | COC1(CNc2nc[nH]c(=O)c2I)CCOC1 |
| InChI | InChI=1S/C10H14IN3O3/c1-16-10(2-3-17-5-10)4-12-8-7(11)9(15)14-6-13-8/h6H,2-5H2,1H3,(H2,12,13,14,15) |
| InChIKey | LVCPRFOLZYEBGP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|