C11H9N3O2 — CID 137016964
2-(4-amino-1,2-oxazol-5-yl)-1H-indol-4-ol (PubChem CID 137016964) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-(4-amino-1,2-oxazol-5-yl)-1H-indol-4-ol.
| Compound Name | 2-(4-amino-1,2-oxazol-5-yl)-1H-indol-4-ol |
|---|---|
| PubChem CID | 137016964 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(4-amino-1,2-oxazol-5-yl)-1H-indol-4-ol |
| SMILES | Nc1cnoc1-c1cc2c(O)cccc2[nH]1 |
| InChI | InChI=1S/C11H9N3O2/c12-7-5-13-16-11(7)9-4-6-8(14-9)2-1-3-10(6)15/h1-5,14-15H,12H2 |
| InChIKey | NUAYIKMLXOEFOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |