C33H20N2O9 — CID 1370198
methyl 4-[5-[2-(4-methoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 1370198) has the molecular formula C33H20N2O9 and a molecular weight of 588.53 g/mol. Its IUPAC name is methyl 4-[5-[2-(4-methoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[2-(4-methoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 1370198 |
| Molecular Formula | C33H20N2O9 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | methyl 4-[5-[2-(4-methoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(C(=O)OC)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C33H20N2O9/c1-43-32(41)17-3-9-21(10-4-17)34-28(37)23-13-7-19(15-25(23)30(34)39)27(36)20-8-14-24-26(16-20)31(40)35(29(24)38)22-11-5-18(6-12-22)33(42)44-2/h3-16H,1-2H3 |
| InChIKey | NTACBRAEWWXSAC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|