C24H22N4O3S2 — CID 137020916
(5S)-1-(3,4-dimethylphenyl)-5-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 137020916) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is (5S)-1-(3,4-dimethylphenyl)-5-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-1-(3,4-dimethylphenyl)-5-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 137020916 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (5S)-1-(3,4-dimethylphenyl)-5-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(/N=C2/NC(=O)/C(=C\[C@H]3C(=O)NC(=S)N(c4ccc(C)c(C)c4)C3=O)S2)cc1 |
| InChI | InChI=1S/C24H22N4O3S2/c1-4-15-6-8-16(9-7-15)25-23-26-21(30)19(33-23)12-18-20(29)27-24(32)28(22(18)31)17-10-5-13(2)14(3)11-17/h5-12,18H,4H2,1-3H3,(H,25,26,30)(H,27,29,32)/b19-12+/t18-/m0/s1 |
| InChIKey | PIMZYJGWXQNGSI-LPGQDOADSA-N |
| XLogP | 3.66 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|