C20H19NO6 — CID 137022502
methyl 4-[4-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenyl]-4-oxobutanoate (PubChem CID 137022502) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is methyl 4-[4-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenyl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 137022502 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 4-[4-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(/C=C/C(=O)c2c(O)cc(C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-12-11-17(24)19(20(26)21-12)16(23)8-5-13-3-6-14(7-4-13)15(22)9-10-18(25)27-2/h3-8,11H,9-10H2,1-2H3,(H2,21,24,26)/b8-5+ |
| InChIKey | QBOBUWOYBBIHPE-VMPITWQZSA-N |
| XLogP | 2.42 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|