C24H31NO5 — CID 54680075
ethyl 4-[3-[(3,5-diethyl-4-hydroxy-6-oxo-1H-pyridin-2-yl)methyl]phenyl]-2-ethyl-3-oxobutanoate (PubChem CID 54680075) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is ethyl 4-[3-[(3,5-diethyl-4-hydroxy-6-oxo-1H-pyridin-2-yl)methyl]phenyl]-2-ethyl-3-oxobutanoate.
| Compound Name | ethyl 4-[3-[(3,5-diethyl-4-hydroxy-6-oxo-1H-pyridin-2-yl)methyl]phenyl]-2-ethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 54680075 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | ethyl 4-[3-[(3,5-diethyl-4-hydroxy-6-oxo-1H-pyridin-2-yl)methyl]phenyl]-2-ethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(CC)C(=O)Cc1cccc(Cc2[nH]c(=O)c(CC)c(O)c2CC)c1 |
| InChI | InChI=1S/C24H31NO5/c1-5-17-20(25-23(28)19(7-3)22(17)27)13-15-10-9-11-16(12-15)14-21(26)18(6-2)24(29)30-8-4/h9-12,18H,5-8,13-14H2,1-4H3,(H2,25,27,28) |
| InChIKey | ROWGTGRRFBSQAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|