C19H24FN3O2 — CID 137025120
2-(4-fluorophenyl)-4-[C-methyl-N-[[(2S)-oxolan-2-yl]methyl]carbonimidoyl]-5-propyl-1H-pyrazol-3-one (PubChem CID 137025120) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[C-methyl-N-[[(2S)-oxolan-2-yl]methyl]carbonimidoyl]-5-propyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-[C-methyl-N-[[(2S)-oxolan-2-yl]methyl]carbonimidoyl]-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137025120 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[C-methyl-N-[[(2S)-oxolan-2-yl]methyl]carbonimidoyl]-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1[nH]n(-c2ccc(F)cc2)c(=O)c1/C(C)=N/C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H24FN3O2/c1-3-5-17-18(13(2)21-12-16-6-4-11-25-16)19(24)23(22-17)15-9-7-14(20)8-10-15/h7-10,16,22H,3-6,11-12H2,1-2H3/b21-13+/t16-/m0/s1 |
| InChIKey | FNEROGYMXZCWRS-REIAIGDLSA-N |
| XLogP | 3.25 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|