C24H33ClF2N6O5 — CID 137025831
tert-butyl 4-[3-[(E)-N-(4,4-difluorocyclohexanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride (PubChem CID 137025831) has the molecular formula C24H33ClF2N6O5 and a molecular weight of 559.01 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-N-(4,4-difluorocyclohexanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-[3-[(E)-N-(4,4-difluorocyclohexanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 137025831 |
| Molecular Formula | C24H33ClF2N6O5 |
| Molecular Weight | 559.01 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | tert-butyl 4-[3-[(E)-N-(4,4-difluorocyclohexanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)[nH]c3c(/C(=N\O)NC(=O)C4CCC(F)(F)CC4)cnn23)CC1.Cl |
| InChI | InChI=1S/C24H32F2N6O5.ClH/c1-23(2,3)37-22(35)31-10-6-14(7-11-31)17-12-18(33)28-20-16(13-27-32(17)20)19(30-36)29-21(34)15-4-8-24(25,26)9-5-15;/h12-15,36H,4-11H2,1-3H3,(H,28,33)(H,29,30,34);1H |
| InChIKey | LAMXWIMSTURZIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.01 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|