C8H8ClNO3 — CID 137028253
(1E)-N,4-dihydroxy-3-methoxybenzenecarboximidoyl chloride (PubChem CID 137028253) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is (1E)-N,4-dihydroxy-3-methoxybenzenecarboximidoyl chloride.
| Compound Name | (1E)-N,4-dihydroxy-3-methoxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 137028253 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | (1E)-N,4-dihydroxy-3-methoxybenzenecarboximidoyl chloride |
| SMILES | COc1cc(/C(Cl)=N\O)ccc1O |
| InChI | InChI=1S/C8H8ClNO3/c1-13-7-4-5(8(9)10-12)2-3-6(7)11/h2-4,11-12H,1H3/b10-8+ |
| InChIKey | BGOCCYKFRLZEJT-CSKARUKUSA-N |
| XLogP | 1.78 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|